Aryl chlorides
![eMolecules 62484-16-6 | 6-Methylquinazoline-2,4(1H,3H)-dione | Combi-Blocks | MFCD00831482 | 176.175 | C9H8N2O2 | 95.000 | Cc1ccc2[nH]c(=O)[nH]c(=O)c2c1 | 1g | 401042274](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502187675.JPG-250.jpg)
eMolecules 62484-16-6 | 6-Methylquinazoline-2,4(1H,3H)-dione | Combi-Blocks | MFCD00831482 | 176.175 | C9H8N2O2 | 95.000 | Cc1ccc2[nH]c(=O)[nH]c(=O)c2c1 | 1g | 401042274
6-Methylquinazoline-2,4(1H,3H)-dione | Combi-Blocks | 62484-16-6 | MFCD00831482 | 176.175 | C9H8N2O2 | 95.000 | Cc1ccc2[nH]c(=O)[nH]c(=O)c2c1 | 1g | 401042274
eMolecules 635-27-8 | AstaTech | 5-CHLOROQUINOLINE | 5g | 448261284 | 23476 | 95 | MFCD00239413 | 163.6 | C9H6ClN
AstaTech | 5-CHLOROQUINOLINE | 5g | 448261284 | 23476 | 95.000 | 635-27-8 | MFCD00239413 | 163.600 | C9H6ClN
Medchemexpress LLC 1,4-dichlorobenzene | 106-46-7 | MFCD00000604 | 99.7% | 147.00 g/mol | C6H4Cl2 | 50g
1 4-Dichlorobenzene is used as an intermediate product in the manufacture of pigments pesticides and disinfectants 1 4-Dichlorobenzene is also employed as a moth control agent[1]
Matrix Scientific CHLOROPYRAZINE-25G
Chloropyrazine, 98%; 25g,C4H3ClN2, MFCD00006124, mw 114.53, [14508-49-7]
Medchemexpress LLC 1,4-dichlorobenzene | 106-46-7 | MFCD00000604 | 99.7% | 147.00 | C6H4Cl2 | 100g
1 4-Dichlorobenzene is used as an intermediate product in the manufacture of pigments pesticides and disinfectants 1 4-Dichlorobenzene is also employed as a moth control agent[1]
eMolecules 13383-44-3 | 3-tert-Butyl-1,2,4-thiadiazol-5-amine | ChemScene | MFCD09865006 | 157.240 | C6H11N3S | 97.000 | CC(C)(C)c1nsc(N)n1 | 100mg | 572174128
3-tert-Butyl-1,2,4-thiadiazol-5-amine | ChemScene | 13383-44-3 | MFCD09865006 | 157.240 | C6H11N3S | 97.000 | CC(C)(C)c1nsc(N)n1 | 100mg | 572174128
eMolecules 108-78-1 | Melamine | Ambeed | MFCD00006055 | 126.123 | C3H6N6 | 98.000 | Nc1nc(N)nc(N)n1 | 25g | 588342046
Melamine | Ambeed | 108-78-1 | MFCD00006055 | 126.123 | C3H6N6 | 98.000 | Nc1nc(N)nc(N)n1 | 25g | 588342046
eMolecules 4316-97-6 | 4,6-Dichloro-5-methylpyrimidine | Ambeed | MFCD01646112 | 163.000 | C5H4Cl2N2 | 98.000 | Cc1c(Cl)ncnc1Cl | 1g | 624119940
4,6-Dichloro-5-methylpyrimidine | Ambeed | 4316-97-6 | MFCD01646112 | 163.000 | C5H4Cl2N2 | 98.000 | Cc1c(Cl)ncnc1Cl | 1g | 624119940
eMolecules 129822-46-4 | 1-BOC-4-Chloroindole | Combi-Blocks | MFCD09025758 | 251.710 | C13H14ClNO2 | 98.000 | CC(C)(C)OC(=O)n1ccc2c(Cl)cccc12 | 1g | 117535390
1-BOC-4-Chloroindole | Combi-Blocks | 129822-46-4 | MFCD09025758 | 251.710 | C13H14ClNO2 | 98.000 | CC(C)(C)OC(=O)n1ccc2c(Cl)cccc12 | 1g | 117535390
![eMolecules 7135-31-1 | 2-Chloroindole | Combi-Blocks, Inc. | MFCD04117990 | 151.590 | C8H6ClN | 95.000 | Clc1cc2ccccc2[nH]1 | 1g | 586079073](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502183694.JPG-250.jpg)
eMolecules 7135-31-1 | 2-Chloroindole | Combi-Blocks, Inc. | MFCD04117990 | 151.590 | C8H6ClN | 95.000 | Clc1cc2ccccc2[nH]1 | 1g | 586079073
2-Chloroindole | Combi-Blocks, Inc. | 7135-31-1 | MFCD04117990 | 151.590 | C8H6ClN | 95.000 | Clc1cc2ccccc2[nH]1 | 1g | 586079073
eMolecules 356783-15-8 | ChemScene | 36-Dichloropyrazine-2-carboxylic acid | 100mg | 632277529 | CS-0042774 | MFCD14581978 | 192.98 | C5H2Cl2N2O2
Medchem Express | Tris-NTA | 5mg | 719836940 | HY-D1288A | 862778-60-7 | 1049.051 | C43H68N8O22
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 101861-63-6 | Ambeed | 46-Dichloroindole-2-carboxylic acid | 1g | 552651127 | A213055 | MFCD00209870 | 230.04 | C9H5Cl2NO2
ChemScene | (S)-56-Difluoro-23-dihydro-1H-inden-1-amine hydrochloride | 100mg | 714103486 | CS-0095511 | 1029689-74-4 | MFCD22393185 | 205.630 | C9H10ClF2N
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Chem-Impex International, Inc. 5-Chloroindole | 17422-32-1 | MFCD00005672 | 100G
5-Chloroindole, 17422-32-1, MFCD00005672, 100G
eMolecules 95206-97-6 | 6-Isopropyl-2-methylpyrimidin-4-amine | Combi-Blocks | MFCD09909804 | 151.213 | C8H13N3 | 95.000 | CC(C)c1cc(N)nc(C)n1 | 1g | 232316379
6-Isopropyl-2-methylpyrimidin-4-amine | Combi-Blocks | 95206-97-6 | MFCD09909804 | 151.213 | C8H13N3 | 95.000 | CC(C)c1cc(N)nc(C)n1 | 1g | 232316379
Medchemexpress LLC 1,4-dichlorobenzene | 106-46-7 | MFCD00000604 | 99.7% | 147.00 | C6H4Cl2 | 25g
1 4-Dichlorobenzene is used as an intermediate product in the manufacture of pigments pesticides and disinfectants 1 4-Dichlorobenzene is also employed as a moth control agent[1]